1982-63-4 Usage
Uses
Used in Pharmaceutical Industry:
2-Furancarboxamide,N-(3-chloro-4-methylphenyl)is used as an intermediate in the synthesis of pharmaceuticals for its potential biological activities. Its unique structure allows it to be a key component in the development of new drugs, contributing to advancements in medicinal chemistry.
Used in Industrial Chemical Production:
In the industrial chemical sector, 2-Furancarboxamide,N-(3-chloro-4-methylphenyl)is utilized as a building block for the creation of various chemical compounds. Its versatility in chemical reactions makes it valuable for producing a range of products used across different industries.
Used in Research and Development:
2-Furancarboxamide,N-(3-chloro-4-methylphenyl)is employed as a research compound for exploring its biological properties and potential applications in drug discovery. Its presence in the scientific community aids in understanding its mechanisms of action and how it can be harnessed for therapeutic purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 1982-63-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,9,8 and 2 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 1982-63:
(6*1)+(5*9)+(4*8)+(3*2)+(2*6)+(1*3)=104
104 % 10 = 4
So 1982-63-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H10ClNO2/c1-8-4-5-9(7-10(8)13)14-12(15)11-3-2-6-16-11/h2-7H,1H3,(H,14,15)
