1984-44-7 Usage
General Description
2,3-Dihydro-2,6,9-trihydroxy-3,4-dimethyl-7-isopropyl-3-(2-propenyl)naphtho[2,3-b]furan-5,8-dione is a complex chemical compound with a long and specific name. It is a naphthofuran compound, meaning it contains a naphthalene ring fused to a furan ring. The chemical also contains multiple hydroxyl (OH) groups and methyl (CH3) groups. Its structure includes an isopropyl group and a propenyl group, indicating the presence of the isopropyl and propenyl functional groups. The compound has potential biological and pharmacological activities, but further research is needed to fully understand its properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1984-44-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,9,8 and 4 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1984-44:
(6*1)+(5*9)+(4*8)+(3*4)+(2*4)+(1*4)=107
107 % 10 = 7
So 1984-44-7 is a valid CAS Registry Number.
InChI:InChI=1/C20H22O6/c1-6-7-20(5)13-9(4)11-12(17(24)18(13)26-19(20)25)14(21)10(8(2)3)15(22)16(11)23/h6,8,19,21,24-25H,1,7H2,2-5H3/t19?,20-/m1/s1