19840-44-9 Usage
Uses
Used in Pharmaceutical Industry:
5-Bromo-6-hydroxypyridine-3-carbonitrile is used as a reagent or intermediate for the synthesis of complex molecules in the pharmaceutical industry. Its unique chemical structure allows for the creation of a variety of compounds with potential therapeutic applications.
Used in Chemical Industry:
In the chemical industry, 5-Bromo-6-hydroxypyridine-3-carbonitrile serves as a key intermediate in the production of various chemical compounds. Its versatile chemical properties make it a valuable component in the synthesis of a range of products, including agrochemicals, dyes, and other specialty chemicals.
Used in Organic Syntheses:
5-Bromo-6-hydroxypyridine-3-carbonitrile is employed as a reagent in organic syntheses, where its unique chemical properties enable the formation of new compounds with specific functionalities. Its presence in the reaction mixture can facilitate the synthesis of target molecules with desired properties, such as improved stability, reactivity, or selectivity.
Used in Research and Development:
5-bromo-6-hydroxypyridine-3-carbonitrile is also utilized in research and development settings, where its unique structure and properties can be explored for potential applications in new areas of chemistry and materials science. Researchers can use 5-Bromo-6-hydroxypyridine-3-carbonitrile to investigate novel reaction pathways, develop new synthetic methods, or discover innovative applications in various fields.
Used in Analytical Chemistry:
5-Bromo-6-hydroxypyridine-3-carbonitrile can be employed as a reference compound or standard in analytical chemistry. Its distinct chemical properties make it suitable for use in calibration of analytical instruments, validation of analytical methods, or as a benchmark in comparative studies.
Check Digit Verification of cas no
The CAS Registry Mumber 19840-44-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,8,4 and 0 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 19840-44:
(7*1)+(6*9)+(5*8)+(4*4)+(3*0)+(2*4)+(1*4)=129
129 % 10 = 9
So 19840-44-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H3BrN2O/c7-5-1-4(2-8)3-9-6(5)10/h1,3H,(H,9,10)
