19855-61-9 Usage
General Description
N, N-Dimethyloctadecylamine acetate is a chemical compound used as a surfactant and emulsifier in various industrial and consumer products. It is a quaternary ammonium compound with a long hydrophobic chain, making it an effective ingredient in fabric softeners, hair conditioners, and emulsions. It helps to reduce surface tension and improve the stability and compatibility of different components in formulations. Additionally, it is used as an antistatic agent in the production of plastics and as a corrosion inhibitor in metalworking fluids. N, N-Dimethyloctadecylamine acetate is known for its low toxicity and biodegradability, making it a widely used and environmentally friendly chemical in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 19855-61-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,8,5 and 5 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 19855-61:
(7*1)+(6*9)+(5*8)+(4*5)+(3*5)+(2*6)+(1*1)=149
149 % 10 = 9
So 19855-61-9 is a valid CAS Registry Number.
InChI:InChI=1/C20H43N.C2H4O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3;1-2(3)4/h4-20H2,1-3H3;1H3,(H,3,4)
