198625-33-1 Usage
General Description
6-(2,5-Dimethylbenzoyl)-3-hydroxy-2-(3-hydroxy-2-quinolinyl)-1H-inden-1-one is a complex organic compound with a unique chemical structure. It contains a benzoyl group, a hydroxy group, and a quinolinyl group, all of which contribute to its potential medicinal properties. 6-(2,5-Dimethylbenzoyl)-3-hydroxy-2-(3-hydroxy-2-quinolinyl)-1H-inden-1-one may have applications in various fields such as pharmaceuticals, organic synthesis, and materials science. Its multifunctional structure and potential reactivity make it a valuable intermediate in the synthesis of other complex organic compounds. Ongoing research into its properties and potential uses may reveal further applications for this intriguing chemical.
Check Digit Verification of cas no
The CAS Registry Mumber 198625-33-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,8,6,2 and 5 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 198625-33:
(8*1)+(7*9)+(6*8)+(5*6)+(4*2)+(3*5)+(2*3)+(1*3)=181
181 % 10 = 1
So 198625-33-1 is a valid CAS Registry Number.
InChI:InChI=1/C27H19NO4/c1-14-7-8-15(2)19(11-14)25(30)17-9-10-18-20(12-17)27(32)23(26(18)31)24-22(29)13-16-5-3-4-6-21(16)28-24/h3-13,29,31H,1-2H3