19870-31-6 Usage
General Description
6-tuliposide A is a natural chemical compound found in certain species of tulip plants, particularly in bulbs and leaves. It belongs to the group of phenolic glycosides and is known for its potential biological activities, including antioxidant, anti-inflammatory, and cytotoxic properties. 6-tuliposide A has gained interest in the fields of pharmaceuticals, cosmetics, and food processing due to its various beneficial effects. It is being explored for its potential applications in the treatment of oxidative stress-related diseases, such as cancer, cardiovascular diseases, and neurodegenerative disorders. Additionally, studies have shown that 6-tuliposide A may have potential as a natural sunscreen agent due to its ability to absorb UV radiation.
Check Digit Verification of cas no
The CAS Registry Mumber 19870-31-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,8,7 and 0 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 19870-31:
(7*1)+(6*9)+(5*8)+(4*7)+(3*0)+(2*3)+(1*1)=136
136 % 10 = 6
So 19870-31-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H18O8/c1-5(2-3-12)10(16)18-4-6-7(13)8(14)9(15)11(17)19-6/h6-9,11-15,17H,1-4H2/t6-,7-,8+,9-,11-/m1/s1
