19875-05-9 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloromethyl-4,6-dichloropyrimidine is used as an intermediate in the synthesis of pharmaceuticals for its role in creating antiviral and anticancer drugs. Its unique structure allows for the development of compounds that can target specific biological pathways, contributing to the treatment of various diseases.
Used in Agrochemical Industry:
In the agrochemical industry, 2-Chloromethyl-4,6-dichloropyrimidine is used as a precursor to prepare pyrimidine-based herbicides and fungicides. Its incorporation into these products helps in the control of weeds and fungi, thereby enhancing crop protection and yield.
Used in Material Science:
2-Chloromethyl-4,6-dichloropyrimidine has potential applications in material science, where its unique properties can be utilized to develop new materials with specific characteristics, such as improved stability or reactivity.
Used in Chemical Process Development:
2-Chloromethyl-4,6-dichloropyrimidine is also used in the development of new chemical processes, where its reactivity and versatility can contribute to the creation of innovative and efficient synthetic routes for the production of various organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 19875-05-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,8,7 and 5 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 19875-05:
(7*1)+(6*9)+(5*8)+(4*7)+(3*5)+(2*0)+(1*5)=149
149 % 10 = 9
So 19875-05-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H3Cl3N2/c6-2-5-9-3(7)1-4(8)10-5/h1H,2H2
