19888-11-0 Usage
General Description
(3aS,6E,8S,10E,11aR)-3a,4,5,8,9,11a-Hexahydro-8-hydroxy-6,10-dimethyl-3-methylenecyclodeca[b]furan-2(3H)-one is a chemical compound with a complex molecular structure. It contains a furan ring and a lactone functional group, making it a cyclic organic compound. The presence of methyl and methylene groups in the molecule indicates its potential for chemical reactivity and biological activity. The hydroxy group suggests that it may have the potential for forming hydrogen bonds and participating in various chemical reactions. (3aS,6E,8S,10E,11aR)-3a,4,5,8,9,11a-Hexahydro-8-hydroxy-6,10-dimethyl-3-methylenecyclodeca[b]furan-2(3H)-one may have significant pharmacological or biological activities, but further research is needed to fully understand its properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 19888-11-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,8,8 and 8 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 19888-11:
(7*1)+(6*9)+(5*8)+(4*8)+(3*8)+(2*1)+(1*1)=160
160 % 10 = 0
So 19888-11-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H20O3/c1-9-4-5-13-11(3)15(17)18-14(13)8-10(2)7-12(16)6-9/h6,8,12-14,16H,3-5,7H2,1-2H3/b9-6+,10-8+/t12-,13+,14-/m1/s1
