19910-65-7 Usage
Description
Di-sec-butyl peroxydicarbonate is an organic peroxide compound known for its sensitivity to heat. It is characterized by its potential as a polymer initiator and requires stringent temperature control measures during storage to ensure safety. Additionally, its explosion hazard is mitigated by mixing the peroxide in a water slurry.
Uses
Used in Polymer Industry:
Di-sec-butyl peroxydicarbonate is used as a polymer initiator for its ability to effectively initiate the polymerization process in various applications. Its heat sensitivity and controlled reaction conditions make it a valuable component in the synthesis of polymers with specific properties and structures.
Since no specific application reasons are provided in the materials, the general use as a polymer initiator is the primary application type mentioned. If there are other industries or specific applications where Di-sec-butyl peroxydicarbonate is used, they would need to be researched and listed separately following the format provided.
Reactivity Profile
DI-SEC-BUTYL PEROXYDICARBONATE decomposes violently or explosively at temperatures 0-10° C. owing to self-accelerating exothermic decomposition; Several explosions were due to shock, heat or friction; amines and certain metals can cause accelerated decomposition [Bretherick, 1979 p. 156].
Safety Profile
Moderately toxic by
skin contact. See also PEROXIDES,
ORGANIC. When heated to decomposition
it emits acrid smoke and irritating fumes.
Check Digit Verification of cas no
The CAS Registry Mumber 19910-65-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,9,1 and 0 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 19910-65:
(7*1)+(6*9)+(5*9)+(4*1)+(3*0)+(2*6)+(1*5)=127
127 % 10 = 7
So 19910-65-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H18O6/c1-5-7(3)13-9(11)15-16-10(12)14-8(4)6-2/h7-8H,5-6H2,1-4H3
19910-65-7Relevant articles and documents
Production of peroxydicarbonates
-
, (2008/06/13)
A process for preparing peroxydicarbonate is disclosed wherein a mixture of chloroformate and dilute aqueous hydrogen peroxide is reacted with a dilute aqueous alkali metal hydroxide solution.
