19977-07-2 Usage
Molecular structure
1-Piperazineethanol, 4-(m-chlorobenzyl)-alpha-(1,3-dimethyl-7-xanthinylmethyl)-, benzoate (ester) has a complex molecular structure that includes a piperazine ring, a benzyl ring, and a benzoate ester group.
Chemical classification
It is a chemical compound belonging to the class of xanthine derivatives and is an ester.
Pharmaceutical use
This compound is commonly used as an intermediate in the synthesis of antihistamines and other pharmaceutical drugs.
Potential therapeutic applications
It has been studied for its potential use in treating various medical conditions, including allergies, inflammation, and cardiovascular diseases.
Anti-cancer properties
The compound has shown promise as a potential anti-cancer agent due to its unique chemical structure and properties.
Drug development
The compound's unique chemical structure and properties make it a valuable component in the development of new drugs and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 19977-07-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,9,7 and 7 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 19977-07:
(7*1)+(6*9)+(5*9)+(4*7)+(3*7)+(2*0)+(1*7)=162
162 % 10 = 2
So 19977-07-2 is a valid CAS Registry Number.
InChI:InChI=1/C28H31ClN6O4/c1-31-25-24(26(36)32(2)28(31)38)35(19-30-25)18-23(39-27(37)21-8-4-3-5-9-21)17-34-13-11-33(12-14-34)16-20-7-6-10-22(29)15-20/h3-10,15,19,23H,11-14,16-18H2,1-2H3