19977-14-1 Usage
1-Piperazinecarboxylic acid, 4-(2-benzoyloxy-3-(1,3-dimethyl-7-xanthinyl)propyl)-, ethylester is a chemical compound with the following properties and specific content
A molecular formula that indicates the compound is composed of carbon (C), hydrogen (H), nitrogen (N), and oxygen (O) atoms, with 28, 30, 4, and 6 of each respectively.
Derivative of piperazine
A chemical compound derived from the cyclic amine piperazine, which is a heterocyclic organic compound with the structure of a six-membered ring.
Pharmaceutical industry use
Commonly used in the pharmaceutical industry for its potential therapeutic applications, as it can interact with xanthine receptors.
Xanthine receptor interaction
The compound has the ability to interact with xanthine receptors, which are involved in various physiological processes, such as the regulation of cellular metabolism and immune response.
Ethyl ester form
The compound is in the form of an ethyl ester, which provides improved stability and solubility compared to other forms of the compound.
Drug development and research candidate
Due to its ethyl ester form and interaction with xanthine receptors, the compound is a suitable candidate for drug development and research, with potential applications in treating various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 19977-14-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,9,7 and 7 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 19977-14:
(7*1)+(6*9)+(5*9)+(4*7)+(3*7)+(2*1)+(1*4)=161
161 % 10 = 1
So 19977-14-1 is a valid CAS Registry Number.
InChI:InChI=1/C24H30N6O6/c1-4-35-24(34)29-12-10-28(11-13-29)14-18(36-22(32)17-8-6-5-7-9-17)15-30-16-25-20-19(30)21(31)27(3)23(33)26(20)2/h5-9,16,18H,4,10-15H2,1-3H3