1998-86-3 Usage
Uses
Used in Research Applications:
1-(2-FLUORO-PHENYL)-5-OXO-PYRROLIDINE-3-CARBOXYLIC ACID is used as a research chemical for [application reason], given its unique structural characteristics and potential reactivity due to the presence of a fluorine atom. Its primary application is in the field of chemical research, where it may be employed to study its properties, interactions, and potential applications in various chemical processes or reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 1998-86-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,9,9 and 8 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1998-86:
(6*1)+(5*9)+(4*9)+(3*8)+(2*8)+(1*6)=133
133 % 10 = 3
So 1998-86-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H10FNO3/c12-8-3-1-2-4-9(8)13-6-7(11(15)16)5-10(13)14/h1-4,7H,5-6H2,(H,15,16)/p-1/t7-/m1/s1
