19997-48-9 Usage
Uses
Used in Pharmaceutical Synthesis:
2-(bromomethyl)-2,3-dihydro-5-methylbenzofuran serves as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Organic Compounds Synthesis:
2-(bromomethyl)-2,3-dihydro-5-methylbenzofuran is utilized as an intermediate in the synthesis of a range of organic compounds, contributing to the advancement of organic chemistry and the creation of novel molecules with specific properties.
Used in Medicinal Chemistry:
2-(bromomethyl)-2,3-dihydro-5-methylbenzofuran is employed in medicinal chemistry for its potential biological activities. Its antiviral and antibacterial properties make it a candidate for the development of new treatments against infectious diseases.
Used in Chemical Biology:
In the field of chemical biology, 2-(bromomethyl)-2,3-dihydro-5-methylbenzofuran is used to explore its interactions with biological systems, potentially leading to the discovery of new bioactive molecules and understanding of biological processes.
Used in Organic Synthesis Research:
2-(bromomethyl)-2,3-dihydro-5-methylbenzofuran is of interest to researchers in organic synthesis due to its unique structure and reactivity, offering opportunities for the development of new synthetic methods and the synthesis of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 19997-48-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,9,9 and 7 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 19997-48:
(7*1)+(6*9)+(5*9)+(4*9)+(3*7)+(2*4)+(1*8)=179
179 % 10 = 9
So 19997-48-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H11BrO/c1-7-2-3-10-8(4-7)5-9(6-11)12-10/h2-4,9H,5-6H2,1H3
