19997-52-5 Usage
Uses
Used in Medicinal Chemistry:
2-(bromomethyl)-2,3-dihydro-5-methoxybenzofuran is used as a building block for the synthesis of new pharmaceutical compounds due to its unique structure and reactivity. Its ability to interact with biological targets makes it a promising candidate for the development of novel drugs.
Used in Drug Development:
In the pharmaceutical industry, 2-(bromomethyl)-2,3-dihydro-5-methoxybenzofuran is used as a key intermediate in the synthesis of various drug molecules. Its specific configuration and substitutions on the benzofuran ring contribute to the development of drugs with improved pharmacological properties and therapeutic effects.
Note: The specific uses and properties of 2-(bromomethyl)-2,3-dihydro-5-methoxybenzofuran would depend on further studies and research into its pharmacological and chemical characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 19997-52-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,9,9 and 7 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 19997-52:
(7*1)+(6*9)+(5*9)+(4*9)+(3*7)+(2*5)+(1*2)=175
175 % 10 = 5
So 19997-52-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H11BrO2/c1-12-8-2-3-10-7(4-8)5-9(6-11)13-10/h2-4,9H,5-6H2,1H3
