The chemical compound "UO2(2+)*C24H14N2O2(2-)=UO2(C24H14N2O2)" represents a complex where the uranium ion UO2(2+) is coordinated with the organic ligand C24H14N2O2(2-). This complex is formed through the interaction between the positively charged uranium(VI) oxide ion and the negatively charged organic ligand, which acts as a chelating agent. The ligand, with the formula C24H14N2O2(2-), is likely a polydentate ligand, meaning it can bind to the metal ion at multiple points, which is common in coordination chemistry. The overall charge of the complex is neutral, as the +2 charge of the uranium ion is balanced by the -2 charge of the ligand. This type of complex is important in various fields, including nuclear chemistry, where uranium complexes are studied for their properties and potential applications.
The CAS Registry Mumber 20002-76-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,0,0 and 2 respectively; the second part has 2 digits, 7 and 6 respectively. Calculate Digit Verification of CAS Registry Number 20002-76: (7*2)+(6*0)+(5*0)+(4*0)+(3*2)+(2*7)+(1*6)=40 40 % 10 = 0 So 20002-76-0 is a valid CAS Registry Number.