200064-23-9 Usage
Uses
Used in Pharmaceutical and Agrochemical Synthesis:
2-ETHOXY-4-(N,N-DIISOPROPYL)AMINOPYRIDINE is used as a building block for the synthesis of pharmaceuticals and agrochemicals, contributing to the development of new drugs and pesticides. Its unique structure allows for the creation of diverse chemical entities with potential therapeutic and pesticidal properties.
Used as a Catalyst in Chemical Reactions:
In the field of organic chemistry, 2-ETHOXY-4-(N,N-DIISOPROPYL)AMINOPYRIDINE serves as a catalyst to facilitate various chemical reactions. Its presence can enhance reaction rates, selectivity, and efficiency, making it a valuable tool in the synthesis of complex organic molecules.
Used in Drug Discovery:
2-ETHOXY-4-(N,N-DIISOPROPYL)AMINOPYRIDINE is utilized in drug discovery processes to identify and optimize potential drug candidates. Its unique properties can be leveraged to design and synthesize novel compounds with improved pharmacological profiles, leading to the development of more effective treatments for various diseases.
Used in Material Science:
In the field of material science, 2-ETHOXY-4-(N,N-DIISOPROPYL)AMINOPYRIDINE can be employed to develop new materials with specific properties. Its incorporation into materials can lead to the creation of advanced materials with applications in various industries, such as electronics, coatings, and adhesives.
Used in Organic Chemistry Research:
2-ETHOXY-4-(N,N-DIISOPROPYL)AMINOPYRIDINE is also used in organic chemistry research to explore new reaction mechanisms, synthetic routes, and the properties of novel compounds. Its unique structure provides a platform for studying various aspects of organic chemistry and contributes to the advancement of the field.
Check Digit Verification of cas no
The CAS Registry Mumber 200064-23-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,0,0,6 and 4 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 200064-23:
(8*2)+(7*0)+(6*0)+(5*0)+(4*6)+(3*4)+(2*2)+(1*3)=59
59 % 10 = 9
So 200064-23-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H22N2O/c1-6-16-13-9-12(7-8-14-13)15(10(2)3)11(4)5/h7-11H,6H2,1-5H3
