20050-76-4 Usage
Uses
Used in Pharmaceutical Industry:
7-HYDROXY-4-METHYL-3-PHENYLCOUMARIN 97 is used as a pharmaceutical agent for its anti-inflammatory and antioxidant properties, contributing to the development of new drugs for various medical conditions. Its enzyme-inhibiting capabilities make it a valuable component in the creation of medications targeting specific health issues.
Used in Cosmetic Industry:
In the cosmetic industry, 7-HYDROXY-4-METHYL-3-PHENYLCOUMARIN 97 is utilized for its beneficial properties, such as reducing inflammation and providing antioxidant support, which can be incorporated into skincare products to enhance their effectiveness and promote skin health.
Used in Perfumery:
7-HYDROXY-4-METHYL-3-PHENYLCOUMARIN 97 is used as a fragrance ingredient in the production of perfumes, where its unique scent characteristics contribute to the overall composition and appeal of the final product.
Used as a Food Additive:
7-HYDROXY-4-METHYL-3-PHENYLCOUMARIN 97 also serves as a food additive, where it may be used to enhance flavor or provide preservative qualities, ensuring the longevity and taste of various food products.
It is crucial to handle 7-HYDROXY-4-METHYL-3-PHENYLCOUMARIN 97 with care, adhering to safety guidelines to minimize potential health risks during its use in different applications.
Check Digit Verification of cas no
The CAS Registry Mumber 20050-76-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,0,5 and 0 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 20050-76:
(7*2)+(6*0)+(5*0)+(4*5)+(3*0)+(2*7)+(1*6)=54
54 % 10 = 4
So 20050-76-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H12O3/c1-10-13-8-7-12(17)9-14(13)19-16(18)15(10)11-5-3-2-4-6-11/h2-9,17H,1H3
