200814-17-1 Usage
Description
1,8-Dihydro-8,8-dimethylpyrano[2,3]quinolin-2-one is a complex and specific chemical compound belonging to the pyranoquinolinone class. It features a cyclic structure with a pyranoquinoline core and two methyl groups at the 8th position, which endows it with unique properties and potential biological activity. 1,8-Dihydro-8,8-dimethylpyrano[2,3]quinolin-2-one is widely recognized in medicinal chemistry research for its diverse biological activities and potential therapeutic applications, making it a promising candidate for the development of new drugs and pharmaceuticals.
Uses
Used in Medicinal Chemistry Research:
1,8-Dihydro-8,8-dimethylpyrano[2,3]quinolin-2-one is used as a research compound for exploring its diverse biological activities and potential therapeutic applications. Its unique structure and properties make it a valuable subject for studying structure-activity relationships and chemical synthesis in the field of medicinal chemistry.
Used in Drug Development:
In the pharmaceutical industry, 1,8-Dihydro-8,8-dimethylpyrano[2,3]quinolin-2-one is utilized as a key component in the development of new drugs. Its potential biological activity and pharmacological properties position it as a promising candidate for creating innovative therapeutic agents to address various health conditions.
Used in Scientific Research:
1,8-Dihydro-8,8-dimethylpyrano[2,3]quinolin-2-one is employed as a versatile compound in various scientific research applications. Its unique structure and potential biological activity make it an intriguing subject for exploring chemical synthesis techniques, structure-activity relationship studies, and other research endeavors in the scientific community.
Check Digit Verification of cas no
The CAS Registry Mumber 200814-17-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,0,8,1 and 4 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 200814-17:
(8*2)+(7*0)+(6*0)+(5*8)+(4*1)+(3*4)+(2*1)+(1*7)=81
81 % 10 = 1
So 200814-17-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H13NO2/c1-14(2)8-7-10-11(17-14)5-3-9-4-6-12(16)15-13(9)10/h3-8H,1-2H3,(H,15,16)
200814-17-1Relevant articles and documents
The first regiospecific synthesis of 8,8-Dimethyl-2H,8H-pyrano[2,3-h]quinolin-2-one and related compounds
Sun,Qing,Chen
, p. 1249 - 1251 (1997)
The title compound was synthesized in eight steps, starting from 6-acetamido-2,2-dimethyl-2H-1-benzopyran-4-one (6). The key steps involved are the regiospecific nitration of 6 and palladium(0)-catalyzed arylation of acrylic acid in aqueous media.
Antitumor agents 187: Synthesis and cytotoxicity of substituted 8,8- dimethyl-2H,8H-pyrano[6,5-h]quinoline-2-one and related compounds
Yang, Zheng-Yu,Xia, Yi,Xia, Peng,Tachibana, Yoko,Bastow, Kenneth F.,Lee, Kuo-Hsiung
, p. 713 - 716 (2007/10/03)
Several substituted 8,8-dimethyl-2H,8H-pyrano[6,5-h]quinoline-2-ones and related compounds were synthesized and evaluated for their in vitro cytotoxicity against a panel of human tumor cell lines. The most active compound (3) showed significant cytotoxic activity with GI50 values in the micromolar range.
