20086-06-0 Usage
Uses
Used in Pharmaceutical Industry:
Diosbulbin B is used as an anti-inflammatory agent for its ability to reduce inflammation, which is beneficial in managing conditions such as arthritis. Its analgesic properties also make it suitable for alleviating pain associated with various ailments.
Used in Pain Management:
Diosbulbin B is utilized as a pain reliever due to its capacity to reduce discomfort and alleviate symptoms in individuals suffering from different types of pain, including chronic and acute conditions.
Used in Anticancer Research:
In the field of oncology, Diosbulbin B is employed as a subject of research for its potential anticancer activity. Studies are ongoing to explore its effects on different types of cancer and how it might be integrated into cancer treatment protocols.
Used in Drug Development:
Diosbulbin B is considered in the development of new drugs, as its bioactive properties could be harnessed to create novel therapeutic agents for various medical conditions, pending further research and clinical trials to confirm its safety and efficacy.
Check Digit Verification of cas no
The CAS Registry Mumber 20086-06-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,0,8 and 6 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 20086-06:
(7*2)+(6*0)+(5*0)+(4*8)+(3*6)+(2*0)+(1*6)=70
70 % 10 = 0
So 20086-06-0 is a valid CAS Registry Number.
InChI:InChI=1/C19H20O6/c1-18-6-13(9-2-3-22-8-9)25-19(18)7-14(24-17(19)21)15-11-4-10(5-12(15)18)23-16(11)20/h2-3,8,10-15H,4-7H2,1H3/t10-,11+,12+,13+,14-,15+,18-,19?/m0/s1