20128-12-5 Usage
Uses
Used in Organic Synthesis:
2,3-Quinoxalinebismethanol diacetate is used as a synthetic intermediate for the preparation of various complex organic molecules. Its stability and reactivity make it a valuable building block in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 2,3-Quinoxalinebismethanol diacetate is used as a lead compound for the development of new drugs. Its potential antiproliferative properties make it a candidate for treatments targeting the proliferation of cancer cells. Additionally, its antimicrobial activity suggests possible applications in the development of new antibiotics or antifungal agents.
Used in Chemical Research:
2,3-Quinoxalinebismethanol diacetate serves as a model compound in chemical research, aiding scientists in understanding the reactivity and properties of quinoxaline-based compounds. This knowledge can be applied to the design of new chemical processes and the discovery of novel compounds with specific therapeutic or industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 20128-12-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,1,2 and 8 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 20128-12:
(7*2)+(6*0)+(5*1)+(4*2)+(3*8)+(2*1)+(1*2)=55
55 % 10 = 5
So 20128-12-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H14N2O4/c1-9(17)19-7-13-14(8-20-10(2)18)16-12-6-4-3-5-11(12)15-13/h3-6H,7-8H2,1-2H3
