202065-25-6 Usage
Description
[1,2,4]Triazolo[1,5-a]pyrimidine-2-carboxylic acid is a heterocyclic chemical compound characterized by a unique fused triazolopyrimidine ring system. With a molecular formula of C6H4N4O2, this compound is known for its potential pharmaceutical applications and its role as a building block in the synthesis of various bioactive molecules and chemical compounds. The presence of a carboxylic acid functional group further enhances its utility in organic synthesis reactions, making it an important compound in the fields of pharmaceuticals and organic chemistry.
Uses
Used in Pharmaceutical Industry:
[1,2,4]Triazolo[1,5-a]pyrimidine-2-carboxylic acid is used as a key intermediate in the synthesis of various pharmaceutical drugs. Its unique chemical structure and properties make it a valuable component in the development of new medications with potential therapeutic benefits.
Used in Organic Synthesis:
[1,2,4]Triazolo[1,5-a]pyrimidine-2-carboxylic acid is used as a building block for the synthesis of various bioactive molecules and chemical compounds. Its carboxylic acid functional group allows for versatile reactions and modifications, contributing to the creation of diverse chemical entities with potential applications in various industries.
Used in Research and Development:
[1,2,4]Triazolo[1,5-a]pyrimidine-2-carboxylic acid is utilized in research and development efforts to explore its potential applications and properties. Its unique structure and reactivity make it an interesting subject for scientific investigation, potentially leading to new discoveries and innovations in the fields of chemistry and medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 202065-25-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,2,0,6 and 5 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 202065-25:
(8*2)+(7*0)+(6*2)+(5*0)+(4*6)+(3*5)+(2*2)+(1*5)=76
76 % 10 = 6
So 202065-25-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H4N4O2/c11-5(12)4-8-6-7-2-1-3-10(6)9-4/h1-3H,(H,11,12)