202865-59-6 Usage
General Description
2-Bromo-4,6-difluoroanisole is a chemically synthesized organic compound that contains bromine, fluorine, and a methoxy group joined to an aromatic ring. Its molecular formula is C7H5BrF2O, and it exhibits aromatic properties due to the presence of a stable, delocalized pi-electron system in its structure. The compound is typically produced in a laboratory setting and finds use in various chemical reactions due to its distinct and versatile structure. As with many other synthetic chemicals, care must be taken when handling 2-Bromo-4,6-difluoanisole due to its potential toxicity and reactive nature.
Check Digit Verification of cas no
The CAS Registry Mumber 202865-59-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,2,8,6 and 5 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 202865-59:
(8*2)+(7*0)+(6*2)+(5*8)+(4*6)+(3*5)+(2*5)+(1*9)=126
126 % 10 = 6
So 202865-59-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H5BrF2O/c1-11-7-5(8)2-4(9)3-6(7)10/h2-3H,1H3