202865-74-5 Usage
Uses
Used in Organic Synthesis:
4-BROMO-2-FLUORO-5-IODOTOLUENE is used as an intermediate in organic synthesis for the production of pharmaceuticals, agrochemicals, and other fine chemicals. Its unique combination of substituents allows for a wide range of chemical reactions, making it a valuable component in the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-BROMO-2-FLUORO-5-IODOTOLUENE is used as a key intermediate in the synthesis of various drugs. Its presence in the molecular structure can influence the pharmacological properties of the final product, such as solubility, stability, and bioavailability.
Used in Agrochemical Industry:
4-BROMO-2-FLUORO-5-IODOTOLUENE is also utilized in the agrochemical industry as an intermediate for the production of pesticides and other crop protection agents. Its unique chemical properties can contribute to the development of more effective and targeted agrochemicals.
Used in Dye and Pigment Manufacturing:
In the dye and pigment manufacturing industry, 4-BROMO-2-FLUORO-5-IODOTOLUENE is used as a building block for the synthesis of dyes, pigments, and other specialty chemicals. Its ability to impart color and stability to these products makes it an essential component in the production of high-quality dyes and pigments.
Used in Specialty Chemicals Production:
4-BROMO-2-FLUORO-5-IODOTOLUENE is employed in the manufacturing of specialty chemicals, where its unique properties can be harnessed to create novel compounds with specific applications. Its versatility in chemical reactions allows for the development of innovative products in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 202865-74-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,2,8,6 and 5 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 202865-74:
(8*2)+(7*0)+(6*2)+(5*8)+(4*6)+(3*5)+(2*7)+(1*4)=125
125 % 10 = 5
So 202865-74-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H5BrFI/c1-4-2-7(10)5(8)3-6(4)9/h2-3H,1H3
