202931-85-9 Usage
Uses
Used in Pharmaceutical Synthesis:
(R)-1-N-BOC-BETA-PROLINE is used as a key building block for the synthesis of pharmaceutical compounds. Its role is crucial in the development of new drugs and the improvement of existing ones, as it can be incorporated into the molecular structure of these compounds to enhance their efficacy and selectivity.
Used in Scientific Research:
In the field of scientific research, (R)-1-N-BOC-BETA-PROLINE is used as a valuable reagent for studying the properties and interactions of various bioactive molecules. Its unique structure and reactivity make it an essential tool for understanding the mechanisms of action and potential applications of these molecules.
Used in Enantioselective Synthesis:
(R)-1-N-BOC-BETA-PROLINE is used as a chiral auxiliary in enantioselective synthesis, which is a method of creating molecules with a specific spatial orientation. This is particularly important in the development of enantiomerically pure compounds, which can have different biological activities and may be more effective or less toxic than their racemic counterparts.
Used in Peptide Construction:
In peptide construction, (R)-1-N-BOC-BETA-PROLINE is used as a component in the synthesis of peptides and proteins. Its stability and reactivity contribute to the formation of well-defined peptide structures, which are essential for their biological functions and potential therapeutic applications.
Used in Biomedical Applications:
(R)-1-N-BOC-BETA-PROLINE is used in the development of bioactive molecules for biomedical applications, such as drug delivery systems, diagnostic tools, and therapeutic agents. Its unique properties and reactivity enable the creation of molecules with specific functions and interactions, which can be tailored to address various medical needs.
Check Digit Verification of cas no
The CAS Registry Mumber 202931-85-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,2,9,3 and 1 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 202931-85:
(8*2)+(7*0)+(6*2)+(5*9)+(4*3)+(3*1)+(2*8)+(1*5)=109
109 % 10 = 9
So 202931-85-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H11N3O/c1-2-3-9-6(4-10)7-5-8-9/h5,10H,2-4H2,1H3
202931-85-9Relevant academic research and scientific papers
Substituted triazolo-pyridazine derivatives as ligands for GABA receptors
-
, (2008/06/13)
Substituted triazolo-pyridazine derivative compounds represented by wherein the variables are disclosed herein are selective ligands for GABA-A receptors, particularly for the α2 and/or α3 subunits.
Substituted 1,2,4-triazolo[3,4-a]phthalazine derivatives as GABA alpha 5 ligands
-
, (2008/06/13)
Substituted 1,2,4-Triazolo[3,4-A]phthalazine derivatives are GABA Alpha 5 ligands and are represented by the formula
