20294-36-4 Usage
Aromatic compound
1-methylindan-5-ol is characterized by the presence of a stable, unsaturated hydrocarbon ring system that exhibits aromaticity.
Hydroxyl group attachment
A hydroxyl group (-OH) is attached to the fifth carbon atom of the indane ring, which influences its chemical properties and reactivity.
Indane ring
The indane ring is a seven-membered cyclic structure that forms the backbone of the 1-methylindan-5-ol molecule.
Synthesis of pharmaceuticals and organic materials
1-methylindan-5-ol is used as a starting material or intermediate in the production of various pharmaceuticals and organic materials due to its unique structure and reactivity.
Potential applications in fragrances and flavors
The aromatic nature of 1-methylindan-5-ol makes it a suitable candidate for the production of fragrances and flavors, adding to its versatility.
Building block for complex molecule synthesis
1-methylindan-5-ol can be used as a building block in organic chemistry research, allowing for the creation of more complex molecules with various applications.
Valuable and versatile chemical compound
The unique structure and reactivity of 1-methylindan-5-ol make it a valuable and versatile compound in various industries, including pharmaceuticals, materials science, and organic chemistry research.
Check Digit Verification of cas no
The CAS Registry Mumber 20294-36-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,2,9 and 4 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 20294-36:
(7*2)+(6*0)+(5*2)+(4*9)+(3*4)+(2*3)+(1*6)=84
84 % 10 = 4
So 20294-36-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H12O/c1-7-2-3-8-6-9(11)4-5-10(7)8/h4-7,11H,2-3H2,1H3
