20320-46-1 Usage
Uses
Used in Pharmaceutical Development:
2-[(4-METHYLPIPERAZIN-1-YL)CARBONYL]BENZOIC ACID is used as a chemical intermediate for the synthesis of various pharmaceuticals, leveraging its potential pharmacological properties to contribute to the development of new drugs. Its specific role in drug development may vary depending on the therapeutic target and the desired pharmacological effect.
Used in Research and Experimentation:
In the field of scientific research, 2-[(4-METHYLPIPERAZIN-1-YL)CARBONYL]BENZOIC ACID serves as a subject of study to explore its chemical properties, reactivity, and potential interactions with biological systems. This research is vital for understanding how the compound can be safely and effectively utilized in drug development and other applications.
Used in Chemical Synthesis:
2-[(4-METHYLPIPERAZIN-1-YL)CARBONYL]BENZOIC ACID is used as a building block in the synthesis of more complex organic molecules, particularly those with potential applications in the pharmaceutical and chemical industries. Its unique structure allows for the creation of novel compounds with specific properties tailored for various uses.
Check Digit Verification of cas no
The CAS Registry Mumber 20320-46-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,3,2 and 0 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 20320-46:
(7*2)+(6*0)+(5*3)+(4*2)+(3*0)+(2*4)+(1*6)=51
51 % 10 = 1
So 20320-46-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H16N2O3/c1-14-6-8-15(9-7-14)12(16)10-4-2-3-5-11(10)13(17)18/h2-5H,6-9H2,1H3,(H,17,18)
20320-46-1Relevant academic research and scientific papers
Design and synthesis of 6-fluoro-2-naphthyl derivatives as novel CCR3 antagonists with reduced CYP2D6 inhibition
Sato, Ippei,Morihira, Koichiro,Inami, Hiroshi,Kubota, Hirokazu,Morokata, Tatsuaki,Suzuki, Keiko,Iura, Yosuke,Nitta, Aiko,Imaoka, Takayuki,Takahashi, Toshiya,Takeuchi, Makoto,Ohta, Mitsuaki,Tsukamoto, Shin-ichi
, p. 8607 - 8618 (2008/12/23)
In our previous study on discovering novel types of CCR3 antagonists, we found a fluoronaphthalene derivative (1) that exhibited potent CCR3 inhibitory activity with an IC50 value of 20 nM. However, compound 1 also inhibited human cytochrome P450 2D6 (CYP2D6) with an IC50 value of 400 nM. In order to reduce its CYP2D6 inhibitory activity, we performed further systematic structural modifications on 1. In particular, we focused on reducing the number of lipophilic moieties in the biphenyl part of 1, using C log D7.4 values as the reference index of lipophilicity. This research led to the identification of N-{(3-exo)-8-[(6-fluoro-2-naphthyl)methyl]-8-azabicyclo[3.2.1]oct-3-yl}-3-(piperidin-1-ylcarbonyl)isonicotinamide 1-oxide (30) which showed comparable CCR3 inhibitory activity (IC50 = 23 nM) with much reduced CYP2D6 inhibitory activity (IC50 = 29,000 nM) compared with 1.
