203268-53-5 Usage
Uses
Used in Pharmaceutical Industry:
2-Hydroxy-4(1H)-pyrimidinethione is used as an intermediate in the synthesis of other chemicals for its ability to be a part of complex molecular structures, contributing to the development of new drugs.
Used in Agricultural Industry:
In the agricultural sector, 2-Hydroxy-4(1H)-pyrimidinethione serves as a building block for the creation of agrochemicals, potentially leading to the development of novel pesticides or other agricultural chemicals.
Used as a Chelating Agent:
2-Hydroxy-4(1H)-pyrimidinethione is utilized as a chelating agent, which allows it to bind to metal ions, forming stable complexes. This property is valuable in various chemical processes and can be applied in different industries for tasks such as water treatment or chemical analysis.
Used in Antiviral and Antifungal Research:
2-Hydroxy-4(1H)-pyrimidinethione has been studied for its potential antiviral and antifungal properties, making it a compound of interest for further research and development in the medical and pharmaceutical fields. Its ability to inhibit viral and fungal growth could lead to new treatments and preventive measures against various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 203268-53-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,3,2,6 and 8 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 203268-53:
(8*2)+(7*0)+(6*3)+(5*2)+(4*6)+(3*8)+(2*5)+(1*3)=105
105 % 10 = 5
So 203268-53-5 is a valid CAS Registry Number.
InChI:InChI=1/C4H4N2OS/c7-4-5-2-1-3(8)6-4/h1-2H,(H2,5,6,7,8)
