20357-30-6 Usage
Uses
Used in Organic Synthesis:
4-BROMO-2-NITROCINNAMIC ACID is used as a key intermediate in the synthesis of various organic compounds due to its reactive bromine and nitro groups, which can be selectively modified to produce a range of derivatives with diverse applications.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 4-BROMO-2-NITROCINNAMIC ACID is utilized as a starting material for the development of new drugs. Its potential biological activities, such as anti-inflammatory and antifungal properties, make it a promising candidate for the treatment of various diseases and conditions.
Used in the Synthesis of Pharmaceutical Intermediates:
4-BROMO-2-NITROCINNAMIC ACID serves as a crucial building block in the preparation of pharmaceutical intermediates. These intermediates are essential for the production of various medications, highlighting the compound's significance in the pharmaceutical manufacturing process.
Overall, 4-BROMO-2-NITROCINNAMIC ACID is a valuable chemical entity with a broad spectrum of applications across different industries, particularly in organic synthesis and pharmaceutical research, where its unique structural features and potential biological activities are harnessed to create innovative products and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 20357-30-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,3,5 and 7 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 20357-30:
(7*2)+(6*0)+(5*3)+(4*5)+(3*7)+(2*3)+(1*0)=76
76 % 10 = 6
So 20357-30-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H6BrNO4/c10-7-3-1-6(2-4-9(12)13)8(5-7)11(14)15/h1-5H,(H,12,13)/b4-2+
