2037-81-2 Usage
General Description
5-AMINO-1,2,3-THIADIAZOLE-N-PHENOXYCARBONYL-4-CARBOXYLIC ACID ETHYL ESTER is a chemical compound with a complex structure, consisting of a 1,2,3-thiadiazole ring with an amino group at the 5th position, and a phenoxy carbonyl and carboxylic acid ethyl ester functional groups attached to the 4-carbon atom. This chemical has potential applications in the pharmaceutical industry for its medicinal properties such as antimicrobial and antifungal activity. It may also have applications in the field of organic synthesis due to its unique structural features and potential reactivity. Further research and development are necessary to fully understand and utilize the properties and potential applications of this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 2037-81-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,0,3 and 7 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 2037-81:
(6*2)+(5*0)+(4*3)+(3*7)+(2*8)+(1*1)=62
62 % 10 = 2
So 2037-81-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H11N3O4S/c1-2-9(16)19-10-11(20-15-14-10)13-12(17)18-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,13,17)
