2037-81-2 Usage
Uses
Used in Pharmaceutical Industry:
5-AMINO-1,2,3-THIADIAZOLE-N-PHENOXYCARBONYL-4-CARBOXYLIC ACID ETHYL ESTER is used as a potential antimicrobial and antifungal agent due to its medicinal properties, offering a new avenue for the development of treatments against various infections.
Used in Organic Synthesis:
In the field of organic synthesis, 5-AMINO-1,2,3-THIADIAZOLE-N-PHENOXYCARBONYL-4-CARBOXYLIC ACID ETHYL ESTER is utilized for its unique structural features and potential reactivity, which may lead to the creation of new compounds with diverse applications.
Further research and development are essential to fully explore and harness the properties and potential applications of this chemical compound across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 2037-81-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,0,3 and 7 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 2037-81:
(6*2)+(5*0)+(4*3)+(3*7)+(2*8)+(1*1)=62
62 % 10 = 2
So 2037-81-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H11N3O4S/c1-2-9(16)19-10-11(20-15-14-10)13-12(17)18-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,13,17)
