203983-14-6 Usage
Description
2-Ethyl-4-phenylindene is a synthetic chemical compound with a unique arrangement of carbon and hydrogen atoms, featuring an ethyl and phenyl group attached to it. It is typically a light-yellow liquid, and its properties such as melting point, boiling point, and density can vary. 2-ETHYL-4-PHENYLINDENE is known for its stabilizing properties, which make it valuable in manufacturing processes.
Uses
Used in Chemical Manufacturing:
2-Ethyl-4-phenylindene is used as a stabilizer in the chemical manufacturing industry to ensure the consistency and quality of the final products. Its stabilizing properties help in maintaining the desired characteristics of the materials being produced.
Used in Research and Development:
In the field of research and development, 2-Ethyl-4-phenylindene may be used as a starting material or intermediate in the synthesis of more complex molecules. Its unique structure and properties make it a potential candidate for further exploration in chemical reactions and applications.
Environmental and Safety Considerations:
Due to the limited information available on the environmental impact and toxicity of 2-Ethyl-4-phenylindene, it is crucial to implement proper safety measures while handling this chemical. This includes using appropriate personal protective equipment, ensuring proper ventilation, and following established guidelines for chemical management and disposal. This approach helps minimize potential risks to public health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 203983-14-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,3,9,8 and 3 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 203983-14:
(8*2)+(7*0)+(6*3)+(5*9)+(4*8)+(3*3)+(2*1)+(1*4)=126
126 % 10 = 6
So 203983-14-6 is a valid CAS Registry Number.
InChI:InChI=1/C17H16/c1-2-13-11-15-9-6-10-16(17(15)12-13)14-7-4-3-5-8-14/h3-10,12H,2,11H2,1H3
