204841-19-0 Usage
Uses
Used in Pharmaceutical Industry:
3-Acetylphenylboronic acid is used as a synthetic intermediate for the development of various pharmaceutical compounds. Its ability to participate in coupling reactions and form biaryls makes it a valuable component in the creation of complex molecular structures with potential therapeutic applications.
Used in Chemical Synthesis:
3-Acetylphenylboronic acid is used as a substrate in the synthesis of symmetric biaryls via oxidative dimerization, utilizing a palladium catalyst and water as a solvent. This process allows for the formation of biaryl compounds, which are important in the development of pharmaceuticals, agrochemicals, and advanced materials.
Used in Fluorination Reactions:
In the chemical industry, 3-Acetylphenylboronic acid is used as a substrate in the synthesis of aryl fluorides through electrophilic fluorination reactions using acetyl hypofluorite. Aryl fluorides are essential components in various chemical products, including pharmaceuticals, agrochemicals, and materials science applications.
Used in Organoborane Coupling Reactions:
3-Acetylphenylboronic acid is used in the coupling reactions of organoboranes with olefins, facilitated by molecular oxygen and a palladium catalyst. This reaction is crucial in the formation of carbon-carbon bonds, which are vital in the synthesis of complex organic molecules and polymers with diverse applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 204841-19-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,4,8,4 and 1 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 204841-19:
(8*2)+(7*0)+(6*4)+(5*8)+(4*4)+(3*1)+(2*1)+(1*9)=110
110 % 10 = 0
So 204841-19-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H9BO3/c1-6(10)7-3-2-4-8(5-7)9(11)12/h2-5,11-12H,1H3
