205873-56-9 Usage
Description
3,4-DIACETAMIDOBENZOIC ACID is an organic compound that serves as a monomer in the synthesis of various polymers, particularly poly(2,5-benzimidazole). It is characterized by the presence of two amide groups attached to a benzoic acid structure, which contributes to its reactivity and potential applications in material science.
Uses
Used in Polymer Synthesis:
3,4-DIACETAMIDOBENZOIC ACID is used as a monomer for the synthesis of poly(2,5-benzimidazole), a high-performance polymer known for its excellent thermal stability, mechanical properties, and chemical resistance. This polymer finds applications in various industries, including aerospace, automotive, and electronics, where materials with superior performance characteristics are required.
Used in Chemical Research:
In the field of chemical research, 3,4-DIACETAMIDOBENZOIC ACID serves as a valuable intermediate for the development of new compounds and materials. Its unique structure allows for further functionalization and modification, enabling the exploration of novel chemical reactions and the creation of advanced materials with tailored properties.
Used in Pharmaceutical Industry:
3,4-DIACETAMIDOBENZOIC ACID may also find applications in the pharmaceutical industry as a building block for the synthesis of drug candidates. Its amide and benzoic acid functionalities can be exploited to design and develop new molecules with potential therapeutic effects, contributing to the discovery of innovative treatments for various diseases and medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 205873-56-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,5,8,7 and 3 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 205873-56:
(8*2)+(7*0)+(6*5)+(5*8)+(4*7)+(3*3)+(2*5)+(1*6)=139
139 % 10 = 9
So 205873-56-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2O4/c1-6(14)12-9-4-3-8(11(16)17)5-10(9)13-7(2)15/h3-5H,1-2H3,(H,12,14)(H,13,15)(H,16,17)/p-1