206362-87-0 Usage
General Description
Methyl 4-chloro-3-fluorobenzoate is a specialized and relatively less common chemical compound that features both fluorine and chlorine atoms as substituents on a benzene ring. This class of compounds, known as halogenated aromatic esters, have unique physical and chemical properties, including relatively high levels of stability and reactivity, which make them useful in a wide range of applications such as dyes, pharmaceuticals, and as intermediates in organic synthesis. Its exact properties can vary depending on the specific ways the compound has been prepared or processed, but it is generally characterized by its reactivity and strong interactions with other chemicals, requiring careful handling and storage.
Check Digit Verification of cas no
The CAS Registry Mumber 206362-87-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,6,3,6 and 2 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 206362-87:
(8*2)+(7*0)+(6*6)+(5*3)+(4*6)+(3*2)+(2*8)+(1*7)=120
120 % 10 = 0
So 206362-87-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClFO2/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4H,1H3