206434-45-9 Usage
Uses
Used in Pharmaceutical Industry:
(S)-3-AMINO-1-ETHYLAZEPAN-2-ONE is used as a building block for the development of various drugs, leveraging its unique chemical structure and properties. Its chiral nature allows for the creation of enantiomerically pure compounds, which are crucial for the efficacy and safety of pharmaceutical agents.
Used as a Chiral Auxiliary in Organic Synthesis:
In the field of organic synthesis, (S)-3-AMINO-1-ETHYLAZEPAN-2-ONE serves as a chiral auxiliary, enabling the synthesis of enantiomerically pure compounds. This is particularly important in the pharmaceutical industry, where the stereochemistry of a drug can significantly impact its activity, selectivity, and potential side effects.
Used in the Synthesis of Pharmaceutical Agents:
(S)-3-AMINO-1-ETHYLAZEPAN-2-ONE exhibits biological activity and has the potential to serve as a precursor or intermediate in the synthesis of pharmaceutical agents. Its unique chemical structure allows for the development of novel therapeutic agents with specific biological targets.
Used in the Study of Organic Chemistry and Pharmacology:
Due to its unique properties and potential applications, (S)-3-AMINO-1-ETHYLAZEPAN-2-ONE is a valuable tool in the study of organic chemistry and pharmacology. Researchers can use (S)-3-AMINO-1-ETHYLAZEPAN-2-ONE to explore new synthetic routes, investigate its biological activity, and understand its role in the development of pharmaceutical agents.
Check Digit Verification of cas no
The CAS Registry Mumber 206434-45-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,6,4,3 and 4 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 206434-45:
(8*2)+(7*0)+(6*6)+(5*4)+(4*3)+(3*4)+(2*4)+(1*5)=109
109 % 10 = 9
So 206434-45-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H16N2O/c1-2-10-6-4-3-5-7(9)8(10)11/h7H,2-6,9H2,1H3/t7-/m0/s1
