206559-45-7 Usage
Uses
Used in Pharmaceutical Industry:
4-Bromophenethylamine Hydrobromide is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and reactivity make it a valuable component in the development of new drugs and medications.
Used in Organic Chemistry:
In the field of organic chemistry, 4-Bromophenethylamine Hydrobromide serves as a key reactant in numerous chemical reactions. Its bromine atom can be substituted with other functional groups, allowing for the creation of a wide range of organic compounds with diverse properties and applications.
Used in Research and Development:
4-Bromophenethylamine Hydrobromide is employed as a research compound in scientific studies and experiments. Its unique properties and reactivity make it an interesting subject for investigation, potentially leading to new discoveries and advancements in the fields of chemistry and medicine.
Used in Chemical Process Optimization:
Due to its enhanced solubility and stability as a hydrobromide salt, 4-Bromophenethylamine Hydrobromide is utilized in optimizing chemical processes. Its improved properties can lead to more efficient reactions, higher yields, and better overall outcomes in various chemical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 206559-45-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,6,5,5 and 9 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 206559-45:
(8*2)+(7*0)+(6*6)+(5*5)+(4*5)+(3*9)+(2*4)+(1*5)=137
137 % 10 = 7
So 206559-45-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H10BrN.BrH/c9-8-3-1-7(2-4-8)5-6-10;/h1-4H,5-6,10H2;1H