20656-08-0 Usage
Uses
Used in Organic Chemistry Research:
2,4-Dichloro-N-(2-hydroxyethyl)benzenecarboxamide is used as a research compound for exploring its chemical properties and potential applications in organic chemistry. Its unique structure with chlorine atoms and a carboxamide group makes it a valuable subject for study in the synthesis of new compounds and materials.
Used in Pharmaceutical Development:
2,4-Dichloro-N-(2-hydroxyethyl)benzenecarboxamide is used as a starting material or intermediate in the synthesis of pharmaceutical compounds. Its aromatic amide structure and functional groups can be utilized in the development of new drugs, particularly in the area of medicinal chemistry.
Used in Chemical Synthesis:
2,4-Dichloro-N-(2-hydroxyethyl)benzenecarboxamide is used as a reagent or catalyst in various chemical synthesis processes. Its presence of chlorine atoms and a carboxamide group can facilitate reactions and transformations, making it a useful component in the production of other chemical compounds.
Used in Material Science:
2,4-Dichloro-N-(2-hydroxyethyl)benzenecarboxamide is used as a component in the development of new materials with specific properties. Its aromatic amide structure and functional groups can contribute to the creation of materials with unique characteristics, such as improved stability, reactivity, or selectivity in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 20656-08-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,6,5 and 6 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 20656-08:
(7*2)+(6*0)+(5*6)+(4*5)+(3*6)+(2*0)+(1*8)=90
90 % 10 = 0
So 20656-08-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H9Cl2NO2/c10-6-1-2-7(8(11)5-6)9(14)12-3-4-13/h1-2,5,13H,3-4H2,(H,12,14)
20656-08-0Relevant academic research and scientific papers
Microwave-Assisted Synthesis of 2-Aryl-2-oxazolines, 5,6-Dihydro-4H-1,3-oxazines, and 4,5,6,7-Tetrahydro-1,3-oxazepines
Mollo, María C.,Orelli, Liliana R.
supporting information, p. 6116 - 6119 (2016/12/09)
The first general procedure for the synthesis of 5- to 7-membered cyclic iminoethers by microwave-assisted cyclization of ω-amido alcohols promoted by polyphosphoric acid (PPA) esters is presented. 2-Aryl-2-oxazolines and 5,6-dihydro-4H-1,3-oxazines were efficiently prepared using ethyl polyphosphate/CHCl3. Trimethylsilyl polyphosphate in solvent-free conditions allowed for the synthesis of hitherto-unreported 4,5,6,7-tetrahydro-1,3-oxazepines. The method involves good to excellent yields and short reaction times.The reaction mechanism and the role of PPA esters were investigated in a chiral substrate.
Oxazolines. 3. Regioselective Synthesis of 2-(Monosubstituted phenyl) and/or Unsymmetrically 2-(Disubstituted phenyl) 2-Oxazolines by Cross-Coupling Grignard Reagents to (Haloaryl)-2-oxazolines
Pridgen, Lendon N.
, p. 4319 - 4323 (2007/10/02)
2-(Monosubstituted phenyl) 2-oxazoline 5 (R = H) and unsymmetrically 2-(disubstituted phenyl) 2-oxazolines 5 have been prepared by cross-coupling alkyl and aryl Grignard reagents to 2-(mono- and dihalogenated phenyl) 2-oxazolines 2 and 3 (X = halogen), re