206660-72-2 Usage
Uses
Used in Organic Synthesis:
cis-3-(Benzyloxy)cyclobutanamine is used as a building block for the creation of more complex molecules, contributing to the development of advanced chemical compounds and materials.
Used as a Chiral Auxiliary:
In the field of asymmetric synthesis, cis-3-(Benzyloxy)cyclobutanamine serves as a chiral auxiliary, aiding in the synthesis of enantiomerically pure compounds, which is crucial for the production of pharmaceuticals and other specialty chemicals.
Used in Pharmaceutical Research:
cis-3-(Benzyloxy)cyclobutanamine is studied for its potential biological and pharmacological properties, including its possible application as a ligand for certain receptors in the central nervous system, which could lead to the development of new therapeutic agents for various conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 206660-72-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,6,6,6 and 0 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 206660-72:
(8*2)+(7*0)+(6*6)+(5*6)+(4*6)+(3*0)+(2*7)+(1*2)=122
122 % 10 = 2
So 206660-72-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO/c12-10-6-11(7-10)13-8-9-4-2-1-3-5-9/h1-5,10-11H,6-8,12H2/t10-,11+
