20674-92-4 Usage
Class
Indole alkaloids
Explanation
Different sources of media describe the Explanation of 20674-92-4 differently. You can refer to the following data:
1. The compound belongs to the class of indole alkaloids, which are naturally occurring organic compounds derived from the indole structure.
2. The compound is a derivative of tryptamine, an organic compound that serves as a precursor to many important biomolecules.
3. The compound has a complex molecular structure, consisting of multiple interconnected rings and functional groups.
4. The compound contains a pyridoindole core, which is a unique structure formed by the fusion of a pyridine ring and an indole ring.
5. A tetrahydrobenzyl group, which is a benzyl group with four additional hydrogen atoms, is attached to the 2-position of the pyridoindole core.
6. A propyl group, a three-carbon alkyl chain, is attached to the 5-position of the pyridoindole core.
7. The compound may exhibit various pharmacological properties, making it potentially useful in research and medicinal applications.
8. The synthesis and specific uses of the compound would need to be determined through additional research and study.
Derivative
Tryptamine
Molecular structure
Complex organic compound
Pyridoindole core
Unique structure
Tetrahydrobenzyl group
2-position
Propyl group
5-position
Pharmacological properties
Potential applications
Synthesis and uses
Further investigation required
Check Digit Verification of cas no
The CAS Registry Mumber 20674-92-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,6,7 and 4 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 20674-92:
(7*2)+(6*0)+(5*6)+(4*7)+(3*4)+(2*9)+(1*2)=104
104 % 10 = 4
So 20674-92-4 is a valid CAS Registry Number.
InChI:InChI=1/C22H27N3/c1-3-12-24-13-11-22-20(16-24)19-6-4-5-7-21(19)25(22)14-10-18-9-8-17(2)23-15-18/h4-9,15H,3,10-14,16H2,1-2H3