20674-94-6 Usage
General Description
The chemical compound "2,3,4,5-Tetrahydro-2-butyl-5-(2-(6-methyl-3-pyridyl)ethyl)-1H-pyrido(4,3-b)indole" is a complex organic molecule with a fused pyridoindole ring system. It contains a butyl group at position 2, and a methylpyridyl ethyl group at position 5 of the pyridoindole ring. 2,3,4,5-Tetrahydro-2-butyl-5-(2-(6-methyl-3-pyridyl)ethyl)-1H-pyrido(4 ,3-b)indole has potential pharmaceutical application and may be of interest for medicinal chemistry research due to its unique structure and potential biological activity. Its pharmacological properties and potential applications would need to be further studied and evaluated to fully understand its potential uses and effects.
Check Digit Verification of cas no
The CAS Registry Mumber 20674-94-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,6,7 and 4 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 20674-94:
(7*2)+(6*0)+(5*6)+(4*7)+(3*4)+(2*9)+(1*4)=106
106 % 10 = 6
So 20674-94-6 is a valid CAS Registry Number.
InChI:InChI=1/C23H29N3/c1-3-4-13-25-14-12-23-21(17-25)20-7-5-6-8-22(20)26(23)15-11-19-10-9-18(2)24-16-19/h5-10,16H,3-4,11-15,17H2,1-2H3