206752-44-5 Usage
General Description
The chemical 2-(benzylmethylamino)-4'-hydroxy-3'- is a compound with a molecular structure containing a benzylmethylamino group, a hydroxyl group, and a phenyl ring. It is commonly used as a building block in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. The compound is known for its potential biological activities, including antioxidant, anti-inflammatory, and anti-cancer properties. Its unique structure makes it a valuable tool for medicinal chemistry research and drug development. Additionally, it has potential applications in the fields of organic synthesis and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 206752-44-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,6,7,5 and 2 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 206752-44:
(8*2)+(7*0)+(6*6)+(5*7)+(4*5)+(3*2)+(2*4)+(1*4)=125
125 % 10 = 5
So 206752-44-5 is a valid CAS Registry Number.
InChI:InChI=1/C17H19NO3.ClH/c1-18(11-13-6-4-3-5-7-13)12-16(20)14-8-9-15(19)17(10-14)21-2;/h3-10,19H,11-12H2,1-2H3;1H