20712-07-6 Usage
Uses
Used in Pharmaceutical Industry:
5-Bromo-benzo[c]isothiazole is used as a synthetic intermediate for the development of new pharmaceutical compounds. Its unique structure allows it to be a key component in the creation of drugs that target specific biological pathways or receptors, potentially leading to the discovery of novel therapeutic agents.
Used in Agricultural Industry:
In agriculture, 5-Bromo-benzo[c]isothiazole is utilized as a building block for the synthesis of agrochemicals. Its incorporation into these compounds can enhance their effectiveness in pest control or crop protection, contributing to more sustainable and efficient agricultural practices.
Used in Material Science:
5-Bromo-benzo[c]isothiazole is employed in material science applications, where its structural properties can be leveraged to develop new materials with specific characteristics. These materials may find use in various industries, such as electronics, where they can improve the performance of devices or components.
Overall, the versatility of 5-Bromo-benzo[c]isothiazole, stemming from its molecular structure, positions it as a valuable compound for research and development across multiple disciplines. Further exploration of its properties and potential applications could lead to significant advancements in drug discovery, agriculture, and material innovation.
Check Digit Verification of cas no
The CAS Registry Mumber 20712-07-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,7,1 and 2 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 20712-07:
(7*2)+(6*0)+(5*7)+(4*1)+(3*2)+(2*0)+(1*7)=66
66 % 10 = 6
So 20712-07-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H4BrNS/c8-6-1-2-7-5(3-6)4-10-9-7/h1-4H
20712-07-6Relevant academic research and scientific papers
CDK INHIBITORS AND THEIR USE AS PHARMACEUTICALS
-
Paragraph 1201-1203, (2021/03/13)
The disclosure is directed to, in part, to CDK inhibitors, pharmaceutical compositions comprising the same, as well as methods of their use and preparation.
Substituted phenylalkanoic acid derivatives and use thereof
-
Page 159, (2008/06/13)
A compound represented by the formula (I) or a salt thereof: wherein n represents an integer of 1 to 3, R represents an alkyl group having 3 to 8 carbon atoms, a group represented by the following formula: R1(CH2)k— (wherein k represents 0 or an integer of 1 to 3; R1 represents a saturated cyclic alkyl group having 3 to 7 carbon atoms or a saturated condensed cyclic alkyl group having 6 to 8 carbon atoms, and the group R1 may be substituted with a lower alkyl group having 1 to 4 carbon atoms) and the like, and Ar represents a condensed bicyclic group such as naphthalen-1-yl group, which has suppressing action on prostaglandin and leukotriene production and is useful for prophylactic and/or therapeutic treatment of various inflammatory diseases and the like caused by these lipid mediators.
