20712-16-7 Usage
Uses
Used in Pharmaceutical Industry:
2-AMINO-5-CHLORO-3-PICOLINE is used as a building block for the synthesis of various pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique structure allows for the creation of diverse chemical entities with potential medicinal applications.
Used in Agrochemical Industry:
In the agrochemical sector, 2-AMINO-5-CHLORO-3-PICOLINE is utilized as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation into these compounds can enhance their effectiveness in controlling pests and weeds, thereby improving crop yields and quality.
Used in Organic Chemistry:
2-AMINO-5-CHLORO-3-PICOLINE is employed as an intermediate in the production of various organic compounds. Its reactivity and functional groups make it a valuable component in the synthesis of complex organic molecules for research and industrial applications.
Used in Biological Research:
2-AMINO-5-CHLORO-3-PICOLINE is studied for its potential as an anti-cancer agent, with research focusing on its ability to target and inhibit the growth of cancer cells. Its anti-inflammatory properties are also of interest, as they may contribute to the development of treatments for inflammatory diseases.
Used in Chemical Production:
As an intermediate in the production of various chemicals, 2-AMINO-5-CHLORO-3-PICOLINE plays a crucial role in the synthesis of a wide range of chemical products. Its versatility and reactivity make it a valuable component in the chemical industry, contributing to the development of new materials and compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 20712-16-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,7,1 and 2 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 20712-16:
(7*2)+(6*0)+(5*7)+(4*1)+(3*2)+(2*1)+(1*6)=67
67 % 10 = 7
So 20712-16-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H7ClN2/c1-4-2-5(7)3-9-6(4)8/h2-3H,1H3,(H2,8,9)
20712-16-7Relevant academic research and scientific papers
COMBINATION THERAPY WITH MDM2 AND EFGR INHIBITORS
-
Page/Page column 165, (2016/01/29)
Provided is a method of treating a proliferative disease, condition, or disorder in a subject by administering a combination of an inhibitor of p53 and MDM2 binding and an EGFR inhibitor. Various embodiments of the disclosed methods provide a synergistic
