207129-35-9 Usage
Uses
Used in Pharmaceutical Synthesis:
(1S,2S,5S)-2-(Hydroxymethyl)-5-vinylquinuclidine is used as a building block in the pharmaceutical industry for the production of various drugs and medicinal compounds. Its chiral properties allow for the creation of enantiomerically pure products, which is crucial for the development of effective and safe medications.
Used in Asymmetric Synthesis:
In the field of organic chemistry, (1S,2S,5S)-2-(Hydroxymethyl)-5-vinylquinuclidine is utilized as a key intermediate in asymmetric synthesis. Its chiral center enables the production of enantiomerically enriched compounds, which are essential for the synthesis of biologically active molecules with specific stereochemistry.
Used in the Development of Novel Materials:
The presence of the vinyl group in (1S,2S,5S)-2-(Hydroxymethyl)-5-vinylquinuclidine makes it a suitable precursor for the development of new materials with unique properties. (1S,2S,5S)-2-(HYDROXYMETHYL)-5-VINYLQUINUCLIDINE can be used in the synthesis of polymers, resins, and other materials with potential applications in various industries.
Used as a Precursor to Alkylated Quinuclidines:
(1S,2S,5S)-2-(Hydroxymethyl)-5-vinylquinuclidine can be further modified through alkylation reactions to produce a range of alkylated quinuclidine derivatives. These derivatives find applications in various chemical and pharmaceutical processes, contributing to the development of new compounds with specific functionalities.
Check Digit Verification of cas no
The CAS Registry Mumber 207129-35-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,7,1,2 and 9 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 207129-35:
(8*2)+(7*0)+(6*7)+(5*1)+(4*2)+(3*9)+(2*3)+(1*5)=109
109 % 10 = 9
So 207129-35-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H17NO/c1-2-8-6-11-4-3-9(8)5-10(11)7-12/h2,8-10,12H,1,3-7H2/t8-,9-,10+/m0/s1
