207511-06-6 Usage
Uses
Used in Pharmaceutical Industry:
Sodium malate is used as a precursor for the synthesis of D-amino acid-based NAD+ analogs. This application is significant because NAD+ analogs play a crucial role in various biological processes, including energy metabolism and redox reactions. By facilitating the production of these analogs, sodium malate contributes to the development of potential therapeutic agents for a range of medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 207511-06-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,7,5,1 and 1 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 207511-06:
(8*2)+(7*0)+(6*7)+(5*5)+(4*1)+(3*1)+(2*0)+(1*6)=96
96 % 10 = 6
So 207511-06-6 is a valid CAS Registry Number.
InChI:InChI=1/C4H6O5.2Na.H2O/c5-2(4(8)9)1-3(6)7;;;/h2,5H,1H2,(H,6,7)(H,8,9);;;1H2/q;2*+1;/p-2/t2-;;;/m0.../s1
