207591-86-4 Usage
Description
4-Nitro-L-phenylalanine monohydrate is an amino acid derivative with a nitro group at the 4-position on the phenyl ring. It is an off-white to light yellow powder and is commonly used in the pharmaceutical industry for the synthesis of various drugs.
Uses
Used in Pharmaceutical Industry:
4-Nitro-L-phenylalanine monohydrate is used as an intermediate in the synthesis of Zolmitriptan, a drug used for the acute treatment of migraine attacks. It plays a crucial role in the development of this medication due to its specific chemical properties that contribute to the drug's effectiveness in treating migraines.
Additionally, p-Nitro-L-phenylalanine, a related compound, is also used in the synthesis of Zolmitriptan (Z639000), further highlighting the importance of this compound and its derivatives in the pharmaceutical sector.
Check Digit Verification of cas no
The CAS Registry Mumber 207591-86-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,7,5,9 and 1 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 207591-86:
(8*2)+(7*0)+(6*7)+(5*5)+(4*9)+(3*1)+(2*8)+(1*6)=144
144 % 10 = 4
So 207591-86-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O4.H2O/c10-8(9(12)13)5-6-1-3-7(4-2-6)11(14)15;/h1-4,8H,5,10H2,(H,12,13);1H2/t8-;/m1./s1