207849-66-9 Usage
Uses
Used in Pharmaceutical Industry:
5-Aminopyrrolo[3,2-b]pyridine is used as a building block for the synthesis of various biologically active compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 5-Aminopyrrolo[3,2-b]pyridine serves as a key component in the creation of compounds with pesticidal properties. Its incorporation into agrochemical products can contribute to more effective pest control solutions.
Used in Dye and Pigment Production:
5-Aminopyrrolo[3,2-b]pyridine is utilized in the production of dyes and pigments due to its chemical properties. Its ability to impart color makes it a valuable component in various industries that require coloring agents, such as textiles, plastics, and inks.
Used in Drug Discovery and Development:
The potential biological activities of 5-Aminopyrrolo[3,2-b]pyridine make it a subject of interest in drug discovery and development. Researchers are exploring its properties to identify new therapeutic targets and develop innovative treatments for various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 207849-66-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,7,8,4 and 9 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 207849-66:
(8*2)+(7*0)+(6*7)+(5*8)+(4*4)+(3*9)+(2*6)+(1*6)=159
159 % 10 = 9
So 207849-66-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3/c8-7-2-1-5-6(10-7)3-4-9-5/h1-4,9H,(H2,8,10)
