207974-19-4 Usage
Uses
Used in Pharmaceutical Industry:
2,3-Difluoromandelic acid is used as an intermediate in the synthesis of pharmaceutical compounds for its enhanced reactivity and unique structural features. The presence of fluorine atoms can improve the pharmacokinetic and pharmacodynamic properties of the resulting drugs, leading to more effective and safer medications.
Used in Agrochemical Industry:
In the agrochemical sector, 2,3-difluoromandelic acid is utilized as a key component in the development of new pesticides and agrochemicals. Its reactivity and structural properties allow for the creation of more potent and selective compounds, contributing to improved crop protection and reduced environmental impact.
Used in Material Synthesis:
2,3-Difluoromandelic acid is employed as a building block in the synthesis of new materials with specific properties. Its unique structure and reactivity enable the development of materials with tailored characteristics for various applications, such as in polymers, coatings, and advanced materials for electronics and energy storage.
Used in Organic Chemistry Research:
As a derivative of mandelic acid, 2,3-difluoromandelic acid serves as a valuable tool in organic chemistry research. Its reactivity and structural features make it an ideal candidate for studying new reaction mechanisms, exploring novel synthetic routes, and understanding the influence of fluorine substitution on chemical behavior.
Check Digit Verification of cas no
The CAS Registry Mumber 207974-19-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,7,9,7 and 4 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 207974-19:
(8*2)+(7*0)+(6*7)+(5*9)+(4*7)+(3*4)+(2*1)+(1*9)=154
154 % 10 = 4
So 207974-19-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H6F2O3/c9-5-3-1-2-4(6(5)10)7(11)8(12)13/h1-3,7,11H,(H,12,13)
