207981-48-4 Usage
Uses
Used in Pharmaceutical Research:
2,3-Difluorocinnamic acid is used as a building block in the development of new drugs due to its potential anti-inflammatory, antioxidant, and anticancer effects. Its unique fluorinated structure contributes to its medicinal properties, making it a valuable compound in the field of drug discovery.
Used in Organic Synthesis:
2,3-Difluorocinnamic acid is used as a substrate in various chemical transformations, particularly in the field of fluorine chemistry. Its fluorinated structure allows for the synthesis of a wide range of compounds with diverse applications.
Used in Anticancer Applications:
2,3-Difluorocinnamic acid is used as a potential anticancer agent, showing promise in the development of new treatments for various types of cancer. Its biological activity and medicinal properties make it a valuable candidate for further research and development in cancer therapy.
Used in Antioxidant and Anti-inflammatory Applications:
2,3-Difluorocinnamic acid is used as a potential antioxidant and anti-inflammatory agent, offering potential benefits in the treatment of various diseases and conditions. Its unique structure and properties make it a promising candidate for further research in these areas.
Check Digit Verification of cas no
The CAS Registry Mumber 207981-48-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,7,9,8 and 1 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 207981-48:
(8*2)+(7*0)+(6*7)+(5*9)+(4*8)+(3*1)+(2*4)+(1*8)=154
154 % 10 = 4
So 207981-48-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H6F2O2/c10-7-3-1-2-6(9(7)11)4-5-8(12)13/h1-5H,(H,12,13)/p-1/b5-4+
