208041-98-9 Usage
Uses
Used in Chemical Industry:
Heptanenitrile, 2-propylis used as a solvent for various chemical processes due to its ability to dissolve a wide range of substances, facilitating reactions and improving efficiency in the production of various chemical products.
Used in Pesticide Production:
Heptanenitrile, 2-propylis used as a key component in the manufacturing of pesticides. Its solvent properties enable the effective delivery of active ingredients, enhancing the performance and efficacy of these agricultural chemicals.
Used in Pharmaceutical Industry:
Heptanenitrile, 2-propylis employed in the production of pharmaceuticals, where it serves as a solvent for the synthesis of various drug compounds. Its ability to dissolve a broad spectrum of substances contributes to the development of new and innovative medications.
Check Digit Verification of cas no
The CAS Registry Mumber 208041-98-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,8,0,4 and 1 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 208041-98:
(8*2)+(7*0)+(6*8)+(5*0)+(4*4)+(3*1)+(2*9)+(1*8)=109
109 % 10 = 9
So 208041-98-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H19N/c1-3-5-6-8-10(9-11)7-4-2/h10H,3-8H2,1-2H3
