208844-07-9 Usage
General Description
2,6-Difluoro-4-(trans-4-ethylcyclohexyl)benzonitrile is a specialized chemical compound featuring a benzonitrile group, widely used in organic chemistry and pharmaceuticals due to its diverse chemical reactivity. The compound holds two fluorine atoms at the second and sixth positions and an ethylcyclohexyl moiety at the fourth position of the benzonitrile ring, which suggests its particular importance in the field of medicinal chemistry where it can be used as a precursor or intermediate. It is not naturally occurring and must be synthesized in a laboratory environment. Specific properties such as reactivity, toxicity, or environmental impact can vary and should be determined per individual use case.
Check Digit Verification of cas no
The CAS Registry Mumber 208844-07-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,8,8,4 and 4 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 208844-07:
(8*2)+(7*0)+(6*8)+(5*8)+(4*4)+(3*4)+(2*0)+(1*7)=139
139 % 10 = 9
So 208844-07-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H17F2N/c1-2-10-3-5-11(6-4-10)12-7-14(16)13(9-18)15(17)8-12/h7-8,10-11H,2-6H2,1H3/t10-,11-