208844-07-9 Usage
Uses
Used in Organic Chemistry:
2,6-Difluoro-4-(trans-4-ethylcyclohexyl)benzonitrile is used as a chemical intermediate for the synthesis of various organic compounds. Its unique structure allows for a range of reactions that can lead to the formation of new molecules with potential applications in different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,6-difluoro-4-(trans-4-ethylcyclohexyl)benzonitrile is used as a precursor in the development of new drugs. Its chemical reactivity and structural features make it a valuable component in the synthesis of potential therapeutic agents, particularly in the area of medicinal chemistry where it can contribute to the creation of novel drug candidates.
Used in Research and Development:
2,6-Difluoro-4-(trans-4-ethylcyclohexyl)benzonitrile is also used in research and development settings, where scientists explore its potential applications and properties. This may include studying its reactivity, stability, and interactions with other compounds, as well as investigating its potential use in the creation of new materials or technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 208844-07-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,8,8,4 and 4 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 208844-07:
(8*2)+(7*0)+(6*8)+(5*8)+(4*4)+(3*4)+(2*0)+(1*7)=139
139 % 10 = 9
So 208844-07-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H17F2N/c1-2-10-3-5-11(6-4-10)12-7-14(16)13(9-18)15(17)8-12/h7-8,10-11H,2-6H2,1H3/t10-,11-
